C26H32O4 — CID 67726586
methyl (Z)-6-[(1R,2S,5S)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-4-enoate (PubChem CID 67726586) has the molecular formula C26H32O4 and a molecular weight of 408.54 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2S,5S)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2S,5S)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67726586 |
| Molecular Formula | C26H32O4 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | methyl (Z)-6-[(1R,2S,5S)-2-(hydroxymethyl)-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](CO)CC[C@@H]1OCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H32O4/c1-29-26(28)11-7-3-6-10-24-23(18-27)16-17-25(24)30-19-20-12-14-22(15-13-20)21-8-4-2-5-9-21/h2-6,8-9,12-15,23-25,27H,7,10-11,16-19H2,1H3/b6-3-/t23-,24-,25+/m1/s1 |
| InChIKey | RVMVYRUZXKDYPY-MJQQETPHSA-N |
| XLogP | 5.16 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|