C32H39NO7 — CID 13150680
acetyloxymethyl (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate (PubChem CID 13150680) has the molecular formula C32H39NO7 and a molecular weight of 549.66 g/mol. Its IUPAC name is acetyloxymethyl (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate.
| Compound Name | acetyloxymethyl (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 13150680 |
| Molecular Formula | C32H39NO7 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | acetyloxymethyl (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
| SMILES | CC(=O)OCOC(=O)CC/C=C\CC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C32H39NO7/c1-24(34)39-23-40-31(36)12-8-3-2-7-11-28-30(21-29(35)32(28)33-17-19-37-20-18-33)38-22-25-13-15-27(16-14-25)26-9-5-4-6-10-26/h2-6,9-10,13-16,28,30,32H,7-8,11-12,17-23H2,1H3/b3-2-/t28-,30-,32+/m0/s1 |
| InChIKey | KWVKFDJYUJCEKK-RNWVWXSOSA-N |
| XLogP | 4.71 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|