C33H41NO7 — CID 54364740
1-acetyloxyethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate (PubChem CID 54364740) has the molecular formula C33H41NO7 and a molecular weight of 563.69 g/mol. Its IUPAC name is 1-acetyloxyethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate.
| Compound Name | 1-acetyloxyethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
|---|---|
| PubChem CID | 54364740 |
| Molecular Formula | C33H41NO7 |
| Molecular Weight | 563.69 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 1-acetyloxyethyl 7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoate |
| SMILES | CC(=O)OC(C)OC(=O)CCC=CCC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C33H41NO7/c1-24(35)40-25(2)41-32(37)13-9-4-3-8-12-29-31(22-30(36)33(29)34-18-20-38-21-19-34)39-23-26-14-16-28(17-15-26)27-10-6-5-7-11-27/h3-7,10-11,14-17,25,29,31,33H,8-9,12-13,18-23H2,1-2H3/t25?,29-,31-,33+/m0/s1 |
| InChIKey | UOZJAIRPIAKDAH-XEBVUXAKSA-N |
| XLogP | 5.10 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.69 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|