C29H37NO4 — CID 70374533
(Z)-7-[(1R,2S,5S)-2-morpholin-4-yl-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid (PubChem CID 70374533) has the molecular formula C29H37NO4 and a molecular weight of 463.62 g/mol. Its IUPAC name is (Z)-7-[(1R,2S,5S)-2-morpholin-4-yl-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2S,5S)-2-morpholin-4-yl-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70374533 |
| Molecular Formula | C29H37NO4 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | (Z)-7-[(1R,2S,5S)-2-morpholin-4-yl-5-[(4-phenylphenyl)methoxy]cyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C29H37NO4/c31-29(32)11-7-2-1-6-10-26-27(30-18-20-33-21-19-30)16-17-28(26)34-22-23-12-14-25(15-13-23)24-8-4-3-5-9-24/h1-5,8-9,12-15,26-28H,6-7,10-11,16-22H2,(H,31,32)/b2-1-/t26-,27+,28+/m1/s1 |
| InChIKey | ILYSNNKZSZPURU-MLFCYBOXSA-N |
| XLogP | 5.55 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|