C30H37NO6 — CID 54360855
7-[(1R,2R,5S)-5-[[4-(3-methoxyphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid (PubChem CID 54360855) has the molecular formula C30H37NO6 and a molecular weight of 507.63 g/mol. Its IUPAC name is 7-[(1R,2R,5S)-5-[[4-(3-methoxyphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid.
| Compound Name | 7-[(1R,2R,5S)-5-[[4-(3-methoxyphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 54360855 |
| Molecular Formula | C30H37NO6 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.26 |
| IUPAC Name | 7-[(1R,2R,5S)-5-[[4-(3-methoxyphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid |
| SMILES | COc1cccc(-c2ccc(CO[C@H]3CC(=O)[C@H](N4CCOCC4)[C@H]3CCC=CCCC(=O)O)cc2)c1 |
| InChI | InChI=1S/C30H37NO6/c1-35-25-8-6-7-24(19-25)23-13-11-22(12-14-23)21-37-28-20-27(32)30(31-15-17-36-18-16-31)26(28)9-4-2-3-5-10-29(33)34/h2-3,6-8,11-14,19,26,28,30H,4-5,9-10,15-18,20-21H2,1H3,(H,33,34)/t26-,28-,30+/m0/s1 |
| InChIKey | UMJPXNWTUYOKIH-BTIIJPOSSA-N |
| XLogP | 4.74 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|