C30H37NO5 — CID 70374535
(Z)-7-[(1R,2R,5S)-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70374535) has the molecular formula C30H37NO5 and a molecular weight of 491.63 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70374535 |
| Molecular Formula | C30H37NO5 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-[[4-(4-methylphenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | Cc1ccc(-c2ccc(CO[C@H]3CC(=O)[C@H](N4CCOCC4)[C@H]3C/C=C\CCCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C30H37NO5/c1-22-8-12-24(13-9-22)25-14-10-23(11-15-25)21-36-28-20-27(32)30(31-16-18-35-19-17-31)26(28)6-4-2-3-5-7-29(33)34/h2,4,8-15,26,28,30H,3,5-7,16-21H2,1H3,(H,33,34)/b4-2-/t26-,28-,30+/m0/s1 |
| InChIKey | XDFSJBOYDYJUJA-IGWOYWMQSA-N |
| XLogP | 5.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|