C28H33NO5 — CID 163892066
(Z)-6-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-5-enoic acid (PubChem CID 163892066) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is (Z)-6-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-5-enoic acid.
| Compound Name | (Z)-6-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-5-enoic acid |
|---|---|
| PubChem CID | 163892066 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | (Z)-6-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[(4-phenylphenyl)methoxy]cyclopentyl]hex-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C28H33NO5/c30-25-19-26(34-20-21-11-13-23(14-12-21)22-7-3-1-4-8-22)24(9-5-2-6-10-27(31)32)28(25)29-15-17-33-18-16-29/h1,3-5,7-9,11-14,24,26,28H,2,6,10,15-20H2,(H,31,32)/b9-5-/t24-,26-,28+/m0/s1 |
| InChIKey | QCJQZFYWGZJRBH-QKZNKMLGSA-N |
| XLogP | 4.34 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|