C29H34ClNO5 — CID 70513681
(Z)-7-[(1R,2R,5S)-5-[[4-(4-chlorophenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70513681) has the molecular formula C29H34ClNO5 and a molecular weight of 512.05 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-5-[[4-(4-chlorophenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-5-[[4-(4-chlorophenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70513681 |
| Molecular Formula | C29H34ClNO5 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-[[4-(4-chlorophenyl)phenyl]methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@@H](OCc2ccc(-c3ccc(Cl)cc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C29H34ClNO5/c30-24-13-11-23(12-14-24)22-9-7-21(8-10-22)20-36-27-19-26(32)29(31-15-17-35-18-16-31)25(27)5-3-1-2-4-6-28(33)34/h1,3,7-14,25,27,29H,2,4-6,15-20H2,(H,33,34)/b3-1-/t25-,27-,29+/m0/s1 |
| InChIKey | WSINVMXWLGYVNG-KQGDVLDNSA-N |
| XLogP | 5.38 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|