C28H35NO5S — CID 70513558
(Z)-7-[(1S,2S,5R)-5-[(4-benzylthiophen-2-yl)methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid (PubChem CID 70513558) has the molecular formula C28H35NO5S and a molecular weight of 497.66 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,5R)-5-[(4-benzylthiophen-2-yl)methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1S,2S,5R)-5-[(4-benzylthiophen-2-yl)methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70513558 |
| Molecular Formula | C28H35NO5S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (Z)-7-[(1S,2S,5R)-5-[(4-benzylthiophen-2-yl)methoxy]-2-morpholin-4-yl-3-oxocyclopentyl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@H]1[C@H](N2CCOCC2)C(=O)C[C@H]1OCc1cc(Cc2ccccc2)cs1 |
| InChI | InChI=1S/C28H35NO5S/c30-25-18-26(34-19-23-17-22(20-35-23)16-21-8-4-3-5-9-21)24(10-6-1-2-7-11-27(31)32)28(25)29-12-14-33-15-13-29/h1,3-6,8-9,17,20,24,26,28H,2,7,10-16,18-19H2,(H,31,32)/b6-1-/t24-,26-,28+/m1/s1 |
| InChIKey | ASCTZXLBTIVXGX-MJBHNACUSA-N |
| XLogP | 4.72 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|