C31H39NO5 — CID 70549533
(Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[3-(4-phenylphenyl)propoxy]cyclopentyl]hept-4-enoic acid (PubChem CID 70549533) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[3-(4-phenylphenyl)propoxy]cyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[3-(4-phenylphenyl)propoxy]cyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70549533 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-2-morpholin-4-yl-3-oxo-5-[3-(4-phenylphenyl)propoxy]cyclopentyl]hept-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC[C@H]1[C@@H](OCCCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C31H39NO5/c33-28-23-29(37-20-8-9-24-14-16-26(17-15-24)25-10-4-3-5-11-25)27(12-6-1-2-7-13-30(34)35)31(28)32-18-21-36-22-19-32/h1-5,10-11,14-17,27,29,31H,6-9,12-13,18-23H2,(H,34,35)/b2-1-/t27-,29-,31+/m0/s1 |
| InChIKey | XRSPQGHCASVORZ-ULAYCDOJSA-N |
| XLogP | 5.16 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|