C26H45NO5 — CID 70549514
(Z)-7-[(1R,2R,5S)-5-decoxy-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid (PubChem CID 70549514) has the molecular formula C26H45NO5 and a molecular weight of 451.65 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,5S)-5-decoxy-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,5S)-5-decoxy-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 70549514 |
| Molecular Formula | C26H45NO5 |
| Molecular Weight | 451.65 g/mol |
| Exact Mass | 451.33 |
| IUPAC Name | (Z)-7-[(1R,2R,5S)-5-decoxy-2-morpholin-4-yl-3-oxocyclopentyl]hept-4-enoic acid |
| SMILES | CCCCCCCCCCO[C@H]1CC(=O)[C@H](N2CCOCC2)[C@H]1CC/C=C\CCC(=O)O |
| InChI | InChI=1S/C26H45NO5/c1-2-3-4-5-6-7-10-13-18-32-24-21-23(28)26(27-16-19-31-20-17-27)22(24)14-11-8-9-12-15-25(29)30/h8-9,22,24,26H,2-7,10-21H2,1H3,(H,29,30)/b9-8-/t22-,24-,26+/m0/s1 |
| InChIKey | VSNXTLIAZPOZAD-JVAAPRNPSA-N |
| XLogP | 5.00 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|