C31H39NO5 — CID 12786406
(E)-7-[5-[[4-(4-methoxyphenyl)phenyl]methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid (PubChem CID 12786406) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (E)-7-[5-[[4-(4-methoxyphenyl)phenyl]methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid.
| Compound Name | (E)-7-[5-[[4-(4-methoxyphenyl)phenyl]methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
|---|---|
| PubChem CID | 12786406 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (E)-7-[5-[[4-(4-methoxyphenyl)phenyl]methoxy]-3-oxo-2-piperidin-1-ylcyclopentyl]hept-4-enoic acid |
| SMILES | COc1ccc(-c2ccc(COC3CC(=O)C(N4CCCCC4)C3CC/C=C/CCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C31H39NO5/c1-36-26-17-15-25(16-18-26)24-13-11-23(12-14-24)22-37-29-21-28(33)31(32-19-7-4-8-20-32)27(29)9-5-2-3-6-10-30(34)35/h2-3,11-18,27,29,31H,4-10,19-22H2,1H3,(H,34,35)/b3-2+ |
| InChIKey | SEMGMBHXUVBUIK-NSCUHMNNSA-N |
| XLogP | 5.89 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|