C27H33NO3 — CID 54122072
(2R,3R,4S)-3-(3-methoxyprop-2-enyl)-4-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentan-1-one (PubChem CID 54122072) has the molecular formula C27H33NO3 and a molecular weight of 419.57 g/mol. Its IUPAC name is (2R,3R,4S)-3-(3-methoxyprop-2-enyl)-4-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentan-1-one.
| Compound Name | (2R,3R,4S)-3-(3-methoxyprop-2-enyl)-4-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentan-1-one |
|---|---|
| PubChem CID | 54122072 |
| Molecular Formula | C27H33NO3 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | (2R,3R,4S)-3-(3-methoxyprop-2-enyl)-4-[(4-phenylphenyl)methoxy]-2-piperidin-1-ylcyclopentan-1-one |
| SMILES | COC=CC[C@H]1[C@@H](OCc2ccc(-c3ccccc3)cc2)CC(=O)[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C27H33NO3/c1-30-18-8-11-24-26(19-25(29)27(24)28-16-6-3-7-17-28)31-20-21-12-14-23(15-13-21)22-9-4-2-5-10-22/h2,4-5,8-10,12-15,18,24,26-27H,3,6-7,11,16-17,19-20H2,1H3/t24-,26-,27+/m0/s1 |
| InChIKey | NOKGWKGRIJWXHR-DOEKTCAHSA-N |
| XLogP | 5.23 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|