C25H29NO2 — CID 22828570
(1R)-5-[(4-phenylphenyl)methoxy]-7-piperidin-1-ylbicyclo[2.2.1]heptan-2-one (PubChem CID 22828570) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1R)-5-[(4-phenylphenyl)methoxy]-7-piperidin-1-ylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1R)-5-[(4-phenylphenyl)methoxy]-7-piperidin-1-ylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 22828570 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (1R)-5-[(4-phenylphenyl)methoxy]-7-piperidin-1-ylbicyclo[2.2.1]heptan-2-one |
| SMILES | O=C1CC2C(OCc3ccc(-c4ccccc4)cc3)C[C@@H]1C2N1CCCCC1 |
| InChI | InChI=1S/C25H29NO2/c27-23-15-22-24(16-21(23)25(22)26-13-5-2-6-14-26)28-17-18-9-11-20(12-10-18)19-7-3-1-4-8-19/h1,3-4,7-12,21-22,24-25H,2,5-6,13-17H2/t21-,22?,24?,25?/m0/s1 |
| InChIKey | WDCGRPTXKWUXLZ-GOUVDAFJSA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |