C14H14O2 — CID 12501307
3-phenylmethoxytricyclo[3.2.0.02,7]heptan-6-one (PubChem CID 12501307) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 3-phenylmethoxytricyclo[3.2.0.02,7]heptan-6-one.
| Compound Name | 3-phenylmethoxytricyclo[3.2.0.02,7]heptan-6-one |
|---|---|
| PubChem CID | 12501307 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 3-phenylmethoxytricyclo[3.2.0.02,7]heptan-6-one |
| SMILES | O=C1C2CC(OCc3ccccc3)C3C1C23 |
| InChI | InChI=1S/C14H14O2/c15-14-9-6-10(12-11(9)13(12)14)16-7-8-4-2-1-3-5-8/h1-5,9-13H,6-7H2 |
| InChIKey | JOISPYACNFZHND-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |