C15H14O3 — CID 134872718
6-phenylmethoxytricyclo[3.2.1.02,7]octane-3,4-dione (PubChem CID 134872718) has the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. Its IUPAC name is 6-phenylmethoxytricyclo[3.2.1.02,7]octane-3,4-dione.
| Compound Name | 6-phenylmethoxytricyclo[3.2.1.02,7]octane-3,4-dione |
|---|---|
| PubChem CID | 134872718 |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 6-phenylmethoxytricyclo[3.2.1.02,7]octane-3,4-dione |
| SMILES | O=C1C(=O)C2C3CC1C(OCc1ccccc1)C32 |
| InChI | InChI=1S/C15H14O3/c16-13-10-6-9-11(14(13)17)12(9)15(10)18-7-8-4-2-1-3-5-8/h1-5,9-12,15H,6-7H2 |
| InChIKey | XDNLKAIHIJIJHC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|