C17H16O2 — CID 10444926
(1S,2S,6S,7R,10R)-10-phenylmethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 10444926) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (1S,2S,6S,7R,10R)-10-phenylmethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2S,6S,7R,10R)-10-phenylmethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 10444926 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (1S,2S,6S,7R,10R)-10-phenylmethoxytricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | O=C1C=C[C@H]2[C@H]3C=C[C@H]([C@@H]3OCc3ccccc3)[C@@H]12 |
| InChI | InChI=1S/C17H16O2/c18-15-9-8-12-13-6-7-14(16(12)15)17(13)19-10-11-4-2-1-3-5-11/h1-9,12-14,16-17H,10H2/t12-,13+,14-,16-,17+/m0/s1 |
| InChIKey | USATTYXTLQFTMU-SSRUIJIPSA-N |
| XLogP | 2.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|