C30H31NO4 — CID 71484239
(1R,2R,3R,8aR)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,8,8a-tetrahydro-1H-indolizin-7-one (PubChem CID 71484239) has the molecular formula C30H31NO4 and a molecular weight of 469.58 g/mol. Its IUPAC name is (1R,2R,3R,8aR)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,8,8a-tetrahydro-1H-indolizin-7-one.
| Compound Name | (1R,2R,3R,8aR)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
|---|---|
| PubChem CID | 71484239 |
| Molecular Formula | C30H31NO4 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | (1R,2R,3R,8aR)-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,8,8a-tetrahydro-1H-indolizin-7-one |
| SMILES | O=C1C=CN2[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2C1 |
| InChI | InChI=1S/C30H31NO4/c32-26-16-17-31-27(18-26)29(34-20-24-12-6-2-7-13-24)30(35-21-25-14-8-3-9-15-25)28(31)22-33-19-23-10-4-1-5-11-23/h1-17,27-30H,18-22H2/t27-,28-,29-,30-/m1/s1 |
| InChIKey | QGGXMNDLGGYYEB-SKKKGAJSSA-N |
| XLogP | 4.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |