C31H37NO3 — CID 46703734
(1S,2R,3S,5S,8aS)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 46703734) has the molecular formula C31H37NO3 and a molecular weight of 471.64 g/mol. Its IUPAC name is (1S,2R,3S,5S,8aS)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | (1S,2R,3S,5S,8aS)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 46703734 |
| Molecular Formula | C31H37NO3 |
| Molecular Weight | 471.64 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | (1S,2R,3S,5S,8aS)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | C[C@H]1CCC[C@H]2[C@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C31H37NO3/c1-24-12-11-19-28-30(34-21-26-15-7-3-8-16-26)31(35-22-27-17-9-4-10-18-27)29(32(24)28)23-33-20-25-13-5-2-6-14-25/h2-10,13-18,24,28-31H,11-12,19-23H2,1H3/t24-,28-,29-,30-,31+/m0/s1 |
| InChIKey | XEYYOUUPLHOWEC-JVNIQAMJSA-N |
| XLogP | 6.00 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |