C37H43NO3Si — CID 57325871
[(1S,5R,6R,7R,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-dimethyl-phenylsilane (PubChem CID 57325871) has the molecular formula C37H43NO3Si and a molecular weight of 577.84 g/mol. Its IUPAC name is [(1S,5R,6R,7R,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-dimethyl-phenylsilane.
| Compound Name | [(1S,5R,6R,7R,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-dimethyl-phenylsilane |
|---|---|
| PubChem CID | 57325871 |
| Molecular Formula | C37H43NO3Si |
| Molecular Weight | 577.84 g/mol |
| Exact Mass | 577.30 |
| IUPAC Name | [(1S,5R,6R,7R,8S)-6,7-bis(phenylmethoxy)-5-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-yl]-dimethyl-phenylsilane |
| SMILES | C[Si](C)(c1ccccc1)[C@H]1CCN2[C@H]1[C@@H](OCc1ccccc1)[C@H](OCc1ccccc1)[C@H]2COCc1ccccc1 |
| InChI | InChI=1S/C37H43NO3Si/c1-42(2,32-21-13-6-14-22-32)34-23-24-38-33(28-39-25-29-15-7-3-8-16-29)36(40-26-30-17-9-4-10-18-30)37(35(34)38)41-27-31-19-11-5-12-20-31/h3-22,33-37H,23-28H2,1-2H3/t33-,34+,35-,36-,37-/m1/s1 |
| InChIKey | LMCJCLVTTHPFSQ-QDVRJJOPSA-N |
| XLogP | 6.82 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.84 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|