C33H43NO5 — CID 90044592
3-[(2R,3R,4R,5R)-1-tert-butyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]propane-1,2-diol (PubChem CID 90044592) has the molecular formula C33H43NO5 and a molecular weight of 533.71 g/mol. Its IUPAC name is 3-[(2R,3R,4R,5R)-1-tert-butyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]propane-1,2-diol.
| Compound Name | 3-[(2R,3R,4R,5R)-1-tert-butyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 90044592 |
| Molecular Formula | C33H43NO5 |
| Molecular Weight | 533.71 g/mol |
| Exact Mass | 533.31 |
| IUPAC Name | 3-[(2R,3R,4R,5R)-1-tert-butyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]propane-1,2-diol |
| SMILES | CC(C)(C)N1[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1CC(O)CO |
| InChI | InChI=1S/C33H43NO5/c1-33(2,3)34-29(19-28(36)20-35)31(38-22-26-15-9-5-10-16-26)32(39-23-27-17-11-6-12-18-27)30(34)24-37-21-25-13-7-4-8-14-25/h4-18,28-32,35-36H,19-24H2,1-3H3/t28?,29-,30-,31-,32-/m1/s1 |
| InChIKey | KCDIDIBRSDFWSJ-REHHZZIGSA-N |
| XLogP | 4.97 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |