C15H24O4 — CID 163035504
(4R)-5,5-dimethyl-6-phenylmethoxyhexane-1,2,4-triol (PubChem CID 163035504) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is (4R)-5,5-dimethyl-6-phenylmethoxyhexane-1,2,4-triol.
| Compound Name | (4R)-5,5-dimethyl-6-phenylmethoxyhexane-1,2,4-triol |
|---|---|
| PubChem CID | 163035504 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | (4R)-5,5-dimethyl-6-phenylmethoxyhexane-1,2,4-triol |
| SMILES | CC(C)(COCc1ccccc1)[C@H](O)CC(O)CO |
| InChI | InChI=1S/C15H24O4/c1-15(2,14(18)8-13(17)9-16)11-19-10-12-6-4-3-5-7-12/h3-7,13-14,16-18H,8-11H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | GOFUDGXBPMHIQQ-ARLHGKGLSA-N |
| XLogP | 1.33 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |