C12H17FO2 — CID 121002722
(2S,3R)-3-fluoro-3-methyl-4-phenylmethoxybutan-2-ol (PubChem CID 121002722) has the molecular formula C12H17FO2 and a molecular weight of 212.26 g/mol. Its IUPAC name is (2S,3R)-3-fluoro-3-methyl-4-phenylmethoxybutan-2-ol.
| Compound Name | (2S,3R)-3-fluoro-3-methyl-4-phenylmethoxybutan-2-ol |
|---|---|
| PubChem CID | 121002722 |
| Molecular Formula | C12H17FO2 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2S,3R)-3-fluoro-3-methyl-4-phenylmethoxybutan-2-ol |
| SMILES | C[C@H](O)[C@](C)(F)COCc1ccccc1 |
| InChI | InChI=1S/C12H17FO2/c1-10(14)12(2,13)9-15-8-11-6-4-3-5-7-11/h3-7,10,14H,8-9H2,1-2H3/t10-,12+/m0/s1 |
| InChIKey | ACOWOXZKUHLEMF-CMPLNLGQSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |