C30H35NO3 — CID 46188980
(1S,2S,3S,5S,8S)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 46188980) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is (1S,2S,3S,5S,8S)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | (1S,2S,3S,5S,8S)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 46188980 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | (1S,2S,3S,5S,8S)-5-methyl-1,2-bis(phenylmethoxy)-3-(phenylmethoxymethyl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C[C@H]1CC[C@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](COCc3ccccc3)N12 |
| InChI | InChI=1S/C30H35NO3/c1-23-17-18-27-29(33-20-25-13-7-3-8-14-25)30(34-21-26-15-9-4-10-16-26)28(31(23)27)22-32-19-24-11-5-2-6-12-24/h2-16,23,27-30H,17-22H2,1H3/t23-,27-,28-,29-,30-/m0/s1 |
| InChIKey | UCPXZQBNLJMDMD-LTUSVDMXSA-N |
| XLogP | 5.61 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |