C30H33NO6 — CID 101233499
methyl (2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate (PubChem CID 101233499) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is methyl (2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate.
| Compound Name | methyl (2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
|---|---|
| PubChem CID | 101233499 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | methyl (2R,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O1 |
| InChI | InChI=1S/C30H33NO6/c1-33-30(32)27-17-25-28(35-19-23-13-7-3-8-14-23)29(36-20-24-15-9-4-10-16-24)26(31(25)37-27)21-34-18-22-11-5-2-6-12-22/h2-16,25-29H,17-21H2,1H3/t25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | BOZAQBBPFJGQTL-HWVUQVAQSA-N |
| XLogP | 4.30 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |