C27H33NO9 — CID 101207863
dimethyl (2R,3R,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 101207863) has the molecular formula C27H33NO9 and a molecular weight of 515.56 g/mol. Its IUPAC name is dimethyl (2R,3R,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3R,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101207863 |
| Molecular Formula | C27H33NO9 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | dimethyl (2R,3R,3aR,4R,5R,6R)-4-(methoxymethoxy)-5-phenylmethoxy-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | COCO[C@H]1[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)N2O[C@@H](C(=O)OC)[C@H](C(=O)OC)[C@H]12 |
| InChI | InChI=1S/C27H33NO9/c1-31-17-36-25-22-21(26(29)32-2)24(27(30)33-3)37-28(22)20(16-34-14-18-10-6-4-7-11-18)23(25)35-15-19-12-8-5-9-13-19/h4-13,20-25H,14-17H2,1-3H3/t20-,21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | IYFYUWICQANLJM-VRVGQERDSA-N |
| XLogP | 2.11 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|