C32H35NO8 — CID 101233498
dimethyl (2R,3S,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate (PubChem CID 101233498) has the molecular formula C32H35NO8 and a molecular weight of 561.63 g/mol. Its IUPAC name is dimethyl (2R,3S,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate.
| Compound Name | dimethyl (2R,3S,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
|---|---|
| PubChem CID | 101233498 |
| Molecular Formula | C32H35NO8 |
| Molecular Weight | 561.63 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | dimethyl (2R,3S,3aR,4R,5R,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)-2,3,3a,4,5,6-hexahydropyrrolo[1,2-b][1,2]oxazole-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](COCc3ccccc3)N2O[C@H]1C(=O)OC |
| InChI | InChI=1S/C32H35NO8/c1-36-31(34)26-27-30(40-20-24-16-10-5-11-17-24)28(39-19-23-14-8-4-9-15-23)25(33(27)41-29(26)32(35)37-2)21-38-18-22-12-6-3-7-13-22/h3-17,25-30H,18-21H2,1-2H3/t25-,26+,27-,28-,29-,30-/m1/s1 |
| InChIKey | UBDHIIYEVMAHIA-UOSKWKFBSA-N |
| XLogP | 3.70 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |