C33H39NO6 — CID 71764043
methyl (E,3R)-3-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]hex-4-enoate (PubChem CID 71764043) has the molecular formula C33H39NO6 and a molecular weight of 545.68 g/mol. Its IUPAC name is methyl (E,3R)-3-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]hex-4-enoate.
| Compound Name | methyl (E,3R)-3-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]hex-4-enoate |
|---|---|
| PubChem CID | 71764043 |
| Molecular Formula | C33H39NO6 |
| Molecular Weight | 545.68 g/mol |
| Exact Mass | 545.28 |
| IUPAC Name | methyl (E,3R)-3-[(2S,3S,4S,5S)-1-hydroxy-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidin-2-yl]hex-4-enoate |
| SMILES | C/C=C/[C@@H](CC(=O)OC)[C@H]1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](COCc2ccccc2)N1O |
| InChI | InChI=1S/C33H39NO6/c1-3-13-28(20-30(35)37-2)31-33(40-23-27-18-11-6-12-19-27)32(39-22-26-16-9-5-10-17-26)29(34(31)36)24-38-21-25-14-7-4-8-15-25/h3-19,28-29,31-33,36H,20-24H2,1-2H3/b13-3+/t28-,29-,31-,32-,33-/m0/s1 |
| InChIKey | QATPOMXACKQWRN-CPFGFMSBSA-N |
| XLogP | 5.57 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|