C21H24FNO3 — CID 53382141
(2S,3S,4S,5S)-2-ethenyl-4-fluoro-1-hydroxy-3-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 53382141) has the molecular formula C21H24FNO3 and a molecular weight of 357.42 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-ethenyl-4-fluoro-1-hydroxy-3-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2S,3S,4S,5S)-2-ethenyl-4-fluoro-1-hydroxy-3-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 53382141 |
| Molecular Formula | C21H24FNO3 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | (2S,3S,4S,5S)-2-ethenyl-4-fluoro-1-hydroxy-3-phenylmethoxy-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | C=C[C@H]1[C@H](OCc2ccccc2)[C@@H](F)[C@H](COCc2ccccc2)N1O |
| InChI | InChI=1S/C21H24FNO3/c1-2-18-21(26-14-17-11-7-4-8-12-17)20(22)19(23(18)24)15-25-13-16-9-5-3-6-10-16/h2-12,18-21,24H,1,13-15H2/t18-,19-,20-,21-/m0/s1 |
| InChIKey | WCSRVLQZPLFBKT-TUFLPTIASA-N |
| XLogP | 3.75 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|