C34H32O2 — CID 122377578
(1R,2S,4R,5R)-1,5-dibenzyl-4-phenyl-2-phenylmethoxybicyclo[3.2.0]heptan-6-one (PubChem CID 122377578) has the molecular formula C34H32O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is (1R,2S,4R,5R)-1,5-dibenzyl-4-phenyl-2-phenylmethoxybicyclo[3.2.0]heptan-6-one.
| Compound Name | (1R,2S,4R,5R)-1,5-dibenzyl-4-phenyl-2-phenylmethoxybicyclo[3.2.0]heptan-6-one |
|---|---|
| PubChem CID | 122377578 |
| Molecular Formula | C34H32O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | (1R,2S,4R,5R)-1,5-dibenzyl-4-phenyl-2-phenylmethoxybicyclo[3.2.0]heptan-6-one |
| SMILES | O=C1C[C@@]2(Cc3ccccc3)[C@@H](OCc3ccccc3)C[C@H](c3ccccc3)[C@@]12Cc1ccccc1 |
| InChI | InChI=1S/C34H32O2/c35-31-24-33(22-26-13-5-1-6-14-26)32(36-25-28-17-9-3-10-18-28)21-30(29-19-11-4-12-20-29)34(31,33)23-27-15-7-2-8-16-27/h1-20,30,32H,21-25H2/t30-,32+,33+,34+/m1/s1 |
| InChIKey | FEYYYWYCVXRCFI-ZQTBNDFDSA-N |
| XLogP | 7.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |