C27H26O5 — CID 153209161
(2R,6R,7S)-2,6,7-tris(phenylmethoxy)-4-oxaspiro[2.4]heptan-5-one (PubChem CID 153209161) has the molecular formula C27H26O5 and a molecular weight of 430.50 g/mol. Its IUPAC name is (2R,6R,7S)-2,6,7-tris(phenylmethoxy)-4-oxaspiro[2.4]heptan-5-one.
| Compound Name | (2R,6R,7S)-2,6,7-tris(phenylmethoxy)-4-oxaspiro[2.4]heptan-5-one |
|---|---|
| PubChem CID | 153209161 |
| Molecular Formula | C27H26O5 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | (2R,6R,7S)-2,6,7-tris(phenylmethoxy)-4-oxaspiro[2.4]heptan-5-one |
| SMILES | O=C1OC2(C[C@H]2OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C27H26O5/c28-26-24(30-18-21-12-6-2-7-13-21)25(31-19-22-14-8-3-9-15-22)27(32-26)16-23(27)29-17-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2/t23-,24-,25+,27?/m1/s1 |
| InChIKey | WLKXCZKOLLRBIB-ZMZXHRNFSA-N |
| XLogP | 4.44 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |