C15H20O3 — CID 101357836
(4R,5R)-5-methyl-4-phenylmethoxy-5-propan-2-yloxolan-2-one (PubChem CID 101357836) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is (4R,5R)-5-methyl-4-phenylmethoxy-5-propan-2-yloxolan-2-one.
| Compound Name | (4R,5R)-5-methyl-4-phenylmethoxy-5-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 101357836 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | (4R,5R)-5-methyl-4-phenylmethoxy-5-propan-2-yloxolan-2-one |
| SMILES | CC(C)[C@@]1(C)OC(=O)C[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-11(2)15(3)13(9-14(16)18-15)17-10-12-7-5-4-6-8-12/h4-8,11,13H,9-10H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | UJPMKYKFFSMBFU-UKRRQHHQSA-N |
| XLogP | 2.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |