C18H18O3 — CID 15395993
(3S,4S)-4-(2-phenylethyl)-3-phenylmethoxyoxetan-2-one (PubChem CID 15395993) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3S,4S)-4-(2-phenylethyl)-3-phenylmethoxyoxetan-2-one.
| Compound Name | (3S,4S)-4-(2-phenylethyl)-3-phenylmethoxyoxetan-2-one |
|---|---|
| PubChem CID | 15395993 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | (3S,4S)-4-(2-phenylethyl)-3-phenylmethoxyoxetan-2-one |
| SMILES | O=C1O[C@@H](CCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C18H18O3/c19-18-17(20-13-15-9-5-2-6-10-15)16(21-18)12-11-14-7-3-1-4-8-14/h1-10,16-17H,11-13H2/t16-,17-/m0/s1 |
| InChIKey | NJYPIGGJUIDKHS-IRXDYDNUSA-N |
| XLogP | 3.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|