C21H19IO5 — CID 91488552
(2S,3S,6R)-2-(iodomethyl)-3,6-bis(phenylmethoxy)-3,6-dihydro-2H-furo[3,2-b]furan-5-one (PubChem CID 91488552) has the molecular formula C21H19IO5 and a molecular weight of 478.28 g/mol. Its IUPAC name is (2S,3S,6R)-2-(iodomethyl)-3,6-bis(phenylmethoxy)-3,6-dihydro-2H-furo[3,2-b]furan-5-one.
| Compound Name | (2S,3S,6R)-2-(iodomethyl)-3,6-bis(phenylmethoxy)-3,6-dihydro-2H-furo[3,2-b]furan-5-one |
|---|---|
| PubChem CID | 91488552 |
| Molecular Formula | C21H19IO5 |
| Molecular Weight | 478.28 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | (2S,3S,6R)-2-(iodomethyl)-3,6-bis(phenylmethoxy)-3,6-dihydro-2H-furo[3,2-b]furan-5-one |
| SMILES | O=C1OC2=C(O[C@H](CI)[C@@H]2OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C21H19IO5/c22-11-16-17(24-12-14-7-3-1-4-8-14)18-19(26-16)20(21(23)27-18)25-13-15-9-5-2-6-10-15/h1-10,16-17,20H,11-13H2/t16-,17+,20-/m1/s1 |
| InChIKey | XUIPBUPMEZYTEB-FUHIMQAGSA-N |
| XLogP | 3.76 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|