C12H14INO3 — CID 101424110
(4S,5S)-5-(iodomethyl)-4-(phenylmethoxymethyl)-1,3-oxazolidin-2-one (PubChem CID 101424110) has the molecular formula C12H14INO3 and a molecular weight of 347.15 g/mol. Its IUPAC name is (4S,5S)-5-(iodomethyl)-4-(phenylmethoxymethyl)-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-5-(iodomethyl)-4-(phenylmethoxymethyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 101424110 |
| Molecular Formula | C12H14INO3 |
| Molecular Weight | 347.15 g/mol |
| Exact Mass | 347.00 |
| IUPAC Name | (4S,5S)-5-(iodomethyl)-4-(phenylmethoxymethyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](COCc2ccccc2)[C@@H](CI)O1 |
| InChI | InChI=1S/C12H14INO3/c13-6-11-10(14-12(15)17-11)8-16-7-9-4-2-1-3-5-9/h1-5,10-11H,6-8H2,(H,14,15)/t10-,11+/m0/s1 |
| InChIKey | PPRVKMSICLGMNG-WDEREUQCSA-N |
| XLogP | 2.12 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.15 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|