C27H29NO4 — CID 102444690
(4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-one (PubChem CID 102444690) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-one.
| Compound Name | (4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-one |
|---|---|
| PubChem CID | 102444690 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (4R,5R,6S)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-2-one |
| SMILES | O=C1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](COCc2ccccc2)N1 |
| InChI | InChI=1S/C27H29NO4/c29-26-16-25(31-18-22-12-6-2-7-13-22)27(32-19-23-14-8-3-9-15-23)24(28-26)20-30-17-21-10-4-1-5-11-21/h1-15,24-25,27H,16-20H2,(H,28,29)/t24-,25+,27+/m0/s1 |
| InChIKey | VMFVCOWWAFAPKK-ZWEKWIFMSA-N |
| XLogP | 4.26 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |