C20H33NO3Si — CID 53253787
(4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-phenylmethoxypyrrolidin-2-one (PubChem CID 53253787) has the molecular formula C20H33NO3Si and a molecular weight of 363.57 g/mol. Its IUPAC name is (4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 53253787 |
| Molecular Formula | C20H33NO3Si |
| Molecular Weight | 363.57 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (4S,5R)-5-[3-[tert-butyl(dimethyl)silyl]oxypropyl]-4-phenylmethoxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCC[C@H]1NC(=O)C[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H33NO3Si/c1-20(2,3)25(4,5)24-13-9-12-17-18(14-19(22)21-17)23-15-16-10-7-6-8-11-16/h6-8,10-11,17-18H,9,12-15H2,1-5H3,(H,21,22)/t17-,18+/m1/s1 |
| InChIKey | YAIAAMHODCFSOC-MSOLQXFVSA-N |
| XLogP | 4.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|