C31H39NO3Si — CID 122224826
(4S,5R)-5-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-phenylmethoxypyrrolidin-2-one (PubChem CID 122224826) has the molecular formula C31H39NO3Si and a molecular weight of 501.74 g/mol. Its IUPAC name is (4S,5R)-5-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-phenylmethoxypyrrolidin-2-one.
| Compound Name | (4S,5R)-5-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-phenylmethoxypyrrolidin-2-one |
|---|---|
| PubChem CID | 122224826 |
| Molecular Formula | C31H39NO3Si |
| Molecular Weight | 501.74 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (4S,5R)-5-[4-[tert-butyl(diphenyl)silyl]oxybutyl]-4-phenylmethoxypyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](OCCCC[C@H]1NC(=O)C[C@@H]1OCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H39NO3Si/c1-31(2,3)36(26-17-9-5-10-18-26,27-19-11-6-12-20-27)35-22-14-13-21-28-29(23-30(33)32-28)34-24-25-15-7-4-8-16-25/h4-12,15-20,28-29H,13-14,21-24H2,1-3H3,(H,32,33)/t28-,29+/m1/s1 |
| InChIKey | SSBKKTQRKSGIJQ-WDYNHAJCSA-N |
| XLogP | 5.21 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.74 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|