C16H23NO2 — CID 10923310
(5R,6S)-5-methyl-6-(3-phenylmethoxypropyl)piperidin-2-one (PubChem CID 10923310) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is (5R,6S)-5-methyl-6-(3-phenylmethoxypropyl)piperidin-2-one.
| Compound Name | (5R,6S)-5-methyl-6-(3-phenylmethoxypropyl)piperidin-2-one |
|---|---|
| PubChem CID | 10923310 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | (5R,6S)-5-methyl-6-(3-phenylmethoxypropyl)piperidin-2-one |
| SMILES | C[C@@H]1CCC(=O)N[C@H]1CCCOCc1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-13-9-10-16(18)17-15(13)8-5-11-19-12-14-6-3-2-4-7-14/h2-4,6-7,13,15H,5,8-12H2,1H3,(H,17,18)/t13-,15+/m1/s1 |
| InChIKey | BQOBCLMKSXOORV-HIFRSBDPSA-N |
| XLogP | 2.90 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|