C15H19NO3 — CID 69075313
5-(3-phenylmethoxypropyl)piperidine-2,4-dione (PubChem CID 69075313) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 5-(3-phenylmethoxypropyl)piperidine-2,4-dione.
| Compound Name | 5-(3-phenylmethoxypropyl)piperidine-2,4-dione |
|---|---|
| PubChem CID | 69075313 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 5-(3-phenylmethoxypropyl)piperidine-2,4-dione |
| SMILES | O=C1CC(=O)C(CCCOCc2ccccc2)CN1 |
| InChI | InChI=1S/C15H19NO3/c17-14-9-15(18)16-10-13(14)7-4-8-19-11-12-5-2-1-3-6-12/h1-3,5-6,13H,4,7-11H2,(H,16,18) |
| InChIKey | RWFMRRXBNABJHO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|