About CID 136908341
CID 136908341 (PubChem CID 136908341) has the molecular formula C22H23OSi
and a molecular weight of 331.51 g/mol.
Molecular Properties
| Compound Name | CID 136908341 |
| PubChem CID | 136908341 |
| Molecular Formula | C22H23OSi |
| Molecular Weight | 331.51 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | — |
| SMILES | c1ccc(COCCC[Si](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23OSi/c1-4-11-20(12-5-1)19-23-17-10-18-24(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16H,10,17-19H2 |
| InChIKey | PPWCQPOVBSEWKQ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 136908341 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 136908341?
The IUPAC name of CID 136908341 (CID 136908341) is not available.
What is the SMILES notation for CID 136908341?
The canonical SMILES for CID 136908341 is c1ccc(COCCC[Si](c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of CID 136908341?
The InChIKey is PPWCQPOVBSEWKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23OSi/c1-4-11-20(12-5-1)19-23-17-10-18-24(21-13-6-2-7-14-21)22-15-8-3-9-16-22/h1-9,11-16H,10,17-19H2.
What are the key properties of CID 136908341?
CID 136908341 has a molecular weight of 331.51 g/mol, XLogP of 3.90, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 136908341 is sourced from PubChem (CID 136908341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).