C21H35NO2Si — CID 139909546
1-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-4-one (PubChem CID 139909546) has the molecular formula C21H35NO2Si and a molecular weight of 361.60 g/mol. Its IUPAC name is 1-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-4-one.
| Compound Name | 1-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-4-one |
|---|---|
| PubChem CID | 139909546 |
| Molecular Formula | C21H35NO2Si |
| Molecular Weight | 361.60 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 1-benzyl-3-[3-[tert-butyl(dimethyl)silyl]oxypropyl]piperidin-4-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC1CN(Cc2ccccc2)CCC1=O |
| InChI | InChI=1S/C21H35NO2Si/c1-21(2,3)25(4,5)24-15-9-12-19-17-22(14-13-20(19)23)16-18-10-7-6-8-11-18/h6-8,10-11,19H,9,12-17H2,1-5H3 |
| InChIKey | DSBBAFFQLLMFKL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|