C25H43NOSi — CID 177429733
N-benzyl-2-[(1S,3R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-methylidenecyclobutyl]-N-methylethanamine (PubChem CID 177429733) has the molecular formula C25H43NOSi and a molecular weight of 401.71 g/mol. Its IUPAC name is N-benzyl-2-[(1S,3R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-methylidenecyclobutyl]-N-methylethanamine.
| Compound Name | N-benzyl-2-[(1S,3R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-methylidenecyclobutyl]-N-methylethanamine |
|---|---|
| PubChem CID | 177429733 |
| Molecular Formula | C25H43NOSi |
| Molecular Weight | 401.71 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | N-benzyl-2-[(1S,3R)-3-[4-[tert-butyl(dimethyl)silyl]oxybutyl]-2-methylidenecyclobutyl]-N-methylethanamine |
| SMILES | C=C1[C@H](CCCCO[Si](C)(C)C(C)(C)C)C[C@H]1CCN(C)Cc1ccccc1 |
| InChI | InChI=1S/C25H43NOSi/c1-21-23(15-11-12-18-27-28(6,7)25(2,3)4)19-24(21)16-17-26(5)20-22-13-9-8-10-14-22/h8-10,13-14,23-24H,1,11-12,15-20H2,2-7H3/t23-,24-/m1/s1 |
| InChIKey | ICMLKDVQZYJFDM-DNQXCXABSA-N |
| XLogP | 6.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|