C22H26BrN — CID 177414547
N-benzyl-2-[(1S,3S)-3-[(4-bromophenyl)methyl]-2-methylidenecyclobutyl]-N-methylethanamine (PubChem CID 177414547) has the molecular formula C22H26BrN and a molecular weight of 384.36 g/mol. Its IUPAC name is N-benzyl-2-[(1S,3S)-3-[(4-bromophenyl)methyl]-2-methylidenecyclobutyl]-N-methylethanamine.
| Compound Name | N-benzyl-2-[(1S,3S)-3-[(4-bromophenyl)methyl]-2-methylidenecyclobutyl]-N-methylethanamine |
|---|---|
| PubChem CID | 177414547 |
| Molecular Formula | C22H26BrN |
| Molecular Weight | 384.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-benzyl-2-[(1S,3S)-3-[(4-bromophenyl)methyl]-2-methylidenecyclobutyl]-N-methylethanamine |
| SMILES | C=C1[C@H](CCN(C)Cc2ccccc2)C[C@H]1Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H26BrN/c1-17-20(12-13-24(2)16-19-6-4-3-5-7-19)15-21(17)14-18-8-10-22(23)11-9-18/h3-11,20-21H,1,12-16H2,2H3/t20-,21-/m1/s1 |
| InChIKey | QWGHFJRLMVISGI-NHCUHLMSSA-N |
| XLogP | 5.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.36 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|