C22H33N — CID 177460694
N-benzyl-2-[(1S,3R)-3-(cyclohexylmethyl)-2-methylidenecyclobutyl]-N-methylethanamine (PubChem CID 177460694) has the molecular formula C22H33N and a molecular weight of 311.51 g/mol. Its IUPAC name is N-benzyl-2-[(1S,3R)-3-(cyclohexylmethyl)-2-methylidenecyclobutyl]-N-methylethanamine.
| Compound Name | N-benzyl-2-[(1S,3R)-3-(cyclohexylmethyl)-2-methylidenecyclobutyl]-N-methylethanamine |
|---|---|
| PubChem CID | 177460694 |
| Molecular Formula | C22H33N |
| Molecular Weight | 311.51 g/mol |
| Exact Mass | 311.26 |
| IUPAC Name | N-benzyl-2-[(1S,3R)-3-(cyclohexylmethyl)-2-methylidenecyclobutyl]-N-methylethanamine |
| SMILES | C=C1[C@H](CCN(C)Cc2ccccc2)C[C@H]1CC1CCCCC1 |
| InChI | InChI=1S/C22H33N/c1-18-21(16-22(18)15-19-9-5-3-6-10-19)13-14-23(2)17-20-11-7-4-8-12-20/h4,7-8,11-12,19,21-22H,1,3,5-6,9-10,13-17H2,2H3/t21-,22-/m1/s1 |
| InChIKey | QBKHKKUGRFTPED-FGZHOGPDSA-N |
| XLogP | 5.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.51 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|