C26H54O3Si2 — CID 10928807
2,6-bis[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexan-1-one (PubChem CID 10928807) has the molecular formula C26H54O3Si2 and a molecular weight of 470.89 g/mol. Its IUPAC name is 2,6-bis[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexan-1-one.
| Compound Name | 2,6-bis[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 10928807 |
| Molecular Formula | C26H54O3Si2 |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.36 |
| IUPAC Name | 2,6-bis[4-[tert-butyl(dimethyl)silyl]oxybutyl]cyclohexan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCC1CCCC(CCCCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C26H54O3Si2/c1-25(2,3)30(7,8)28-20-13-11-16-22-18-15-19-23(24(22)27)17-12-14-21-29-31(9,10)26(4,5)6/h22-23H,11-21H2,1-10H3 |
| InChIKey | VUZALUIUWSJNFS-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|