C17H36O3Si2 — CID 139700392
tert-butyl-dimethyl-[3-(5-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl)propoxy]silane (PubChem CID 139700392) has the molecular formula C17H36O3Si2 and a molecular weight of 344.64 g/mol. Its IUPAC name is tert-butyl-dimethyl-[3-(5-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl)propoxy]silane.
| Compound Name | tert-butyl-dimethyl-[3-(5-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl)propoxy]silane |
|---|---|
| PubChem CID | 139700392 |
| Molecular Formula | C17H36O3Si2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | tert-butyl-dimethyl-[3-(5-trimethylsilyloxy-3,4-dihydro-2H-pyran-4-yl)propoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC1CCOC=C1O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O3Si2/c1-17(2,3)22(7,8)19-12-9-10-15-11-13-18-14-16(15)20-21(4,5)6/h14-15H,9-13H2,1-8H3 |
| InChIKey | UFTCCUYMNMVBAG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|