C14H27NO3Si — CID 175866159
tert-butyl-dimethyl-[2-(4-nitrocyclohex-3-en-1-yl)ethoxy]silane (PubChem CID 175866159) has the molecular formula C14H27NO3Si and a molecular weight of 285.46 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(4-nitrocyclohex-3-en-1-yl)ethoxy]silane.
| Compound Name | tert-butyl-dimethyl-[2-(4-nitrocyclohex-3-en-1-yl)ethoxy]silane |
|---|---|
| PubChem CID | 175866159 |
| Molecular Formula | C14H27NO3Si |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.18 |
| IUPAC Name | tert-butyl-dimethyl-[2-(4-nitrocyclohex-3-en-1-yl)ethoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCCC1CC=C([N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H27NO3Si/c1-14(2,3)19(4,5)18-11-10-12-6-8-13(9-7-12)15(16)17/h8,12H,6-7,9-11H2,1-5H3 |
| InChIKey | QUOMDMLLVZSJRY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|