C14H25N3O3Si — CID 168827188
1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-nitrobenzene-1,2-diamine (PubChem CID 168827188) has the molecular formula C14H25N3O3Si and a molecular weight of 311.46 g/mol. Its IUPAC name is 1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-nitrobenzene-1,2-diamine.
| Compound Name | 1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-nitrobenzene-1,2-diamine |
|---|---|
| PubChem CID | 168827188 |
| Molecular Formula | C14H25N3O3Si |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-N-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4-nitrobenzene-1,2-diamine |
| SMILES | CC(C)(C)[Si](C)(C)OCCNc1ccc([N+](=O)[O-])cc1N |
| InChI | InChI=1S/C14H25N3O3Si/c1-14(2,3)21(4,5)20-9-8-16-13-7-6-11(17(18)19)10-12(13)15/h6-7,10,16H,8-9,15H2,1-5H3 |
| InChIKey | GZQCDATWALWMCO-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|