C18H27N3O5Si — CID 124735581
(5S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione (PubChem CID 124735581) has the molecular formula C18H27N3O5Si and a molecular weight of 393.52 g/mol. Its IUPAC name is (5S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 124735581 |
| Molecular Formula | C18H27N3O5Si |
| Molecular Weight | 393.52 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (5S)-3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methyl-5-(4-nitrophenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1C(=O)N[C@@](C)(c2ccc([N+](=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C18H27N3O5Si/c1-17(2,3)27(5,6)26-12-11-20-15(22)18(4,19-16(20)23)13-7-9-14(10-8-13)21(24)25/h7-10H,11-12H2,1-6H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | NSYZEFLNHWBPDZ-SFHVURJKSA-N |
| XLogP | 3.38 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|